C14H26N2O3 — CID 145076683
4-(2,5-dioxopyrrol-1-yl)butanal;ethane;N-methylpropan-1-amine (PubChem CID 145076683) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)butanal;ethane;N-methylpropan-1-amine.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)butanal;ethane;N-methylpropan-1-amine |
|---|---|
| PubChem CID | 145076683 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)butanal;ethane;N-methylpropan-1-amine |
| SMILES | CC.CCCNC.O=CCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C8H9NO3.C4H11N.C2H6/c10-6-2-1-5-9-7(11)3-4-8(9)12;1-3-4-5-2;1-2/h3-4,6H,1-2,5H2;5H,3-4H2,1-2H3;1-2H3 |
| InChIKey | YJSHJCUKDFUTJA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|