C7H8N2O3 — CID 118485994
N-[2-(2,5-dioxopyrrol-1-yl)ethyl]formamide (PubChem CID 118485994) has the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. Its IUPAC name is N-[2-(2,5-dioxopyrrol-1-yl)ethyl]formamide.
| Compound Name | N-[2-(2,5-dioxopyrrol-1-yl)ethyl]formamide |
|---|---|
| PubChem CID | 118485994 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | N-[2-(2,5-dioxopyrrol-1-yl)ethyl]formamide |
| SMILES | O=CNCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C7H8N2O3/c10-5-8-3-4-9-6(11)1-2-7(9)12/h1-2,5H,3-4H2,(H,8,10) |
| InChIKey | ZZSUJBLVKGEBOJ-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|