C10H14N2O3 — CID 118088116
N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-2-methylpropanamide (PubChem CID 118088116) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-2-methylpropanamide.
| Compound Name | N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 118088116 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H14N2O3/c1-7(2)10(15)11-5-6-12-8(13)3-4-9(12)14/h3-4,7H,5-6H2,1-2H3,(H,11,15) |
| InChIKey | LUISPCDXSCFGEK-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|