C10H14N2O3S — CID 135303547
3-(2,5-dioxopyrrol-1-yl)-N-(2-sulfanylpropyl)propanamide (PubChem CID 135303547) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-(2-sulfanylpropyl)propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-(2-sulfanylpropyl)propanamide |
|---|---|
| PubChem CID | 135303547 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-(2-sulfanylpropyl)propanamide |
| SMILES | CC(S)CNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H14N2O3S/c1-7(16)6-11-8(13)4-5-12-9(14)2-3-10(12)15/h2-3,7,16H,4-6H2,1H3,(H,11,13) |
| InChIKey | DCZVPWXECXUDPP-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|