C17H22N2O5 — CID 158686357
cyclopent-4-ene-1,3-dione;3-(2,5-dioxopyrrol-1-yl)-N-(2-methylbutyl)propanamide (PubChem CID 158686357) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is cyclopent-4-ene-1,3-dione;3-(2,5-dioxopyrrol-1-yl)-N-(2-methylbutyl)propanamide.
| Compound Name | cyclopent-4-ene-1,3-dione;3-(2,5-dioxopyrrol-1-yl)-N-(2-methylbutyl)propanamide |
|---|---|
| PubChem CID | 158686357 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | cyclopent-4-ene-1,3-dione;3-(2,5-dioxopyrrol-1-yl)-N-(2-methylbutyl)propanamide |
| SMILES | CCC(C)CNC(=O)CCN1C(=O)C=CC1=O.O=C1C=CC(=O)C1 |
| InChI | InChI=1S/C12H18N2O3.C5H4O2/c1-3-9(2)8-13-10(15)6-7-14-11(16)4-5-12(14)17;6-4-1-2-5(7)3-4/h4-5,9H,3,6-8H2,1-2H3,(H,13,15);1-2H,3H2 |
| InChIKey | IFUDTNJAWVZFJS-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|