C12H18N2O5 — CID 81063012
4-[3-(2,5-dioxopyrrolidin-1-yl)propanoylamino]-3-methylbutanoic acid (PubChem CID 81063012) has the molecular formula C12H18N2O5 and a molecular weight of 270.28 g/mol. Its IUPAC name is 4-[3-(2,5-dioxopyrrolidin-1-yl)propanoylamino]-3-methylbutanoic acid.
| Compound Name | 4-[3-(2,5-dioxopyrrolidin-1-yl)propanoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 81063012 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 4-[3-(2,5-dioxopyrrolidin-1-yl)propanoylamino]-3-methylbutanoic acid |
| SMILES | CC(CNC(=O)CCN1C(=O)CCC1=O)CC(=O)O |
| InChI | InChI=1S/C12H18N2O5/c1-8(6-12(18)19)7-13-9(15)4-5-14-10(16)2-3-11(14)17/h8H,2-7H2,1H3,(H,13,15)(H,18,19) |
| InChIKey | YNNSNMLKRTYSSZ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|