C11H15N3O6 — CID 107820981
(2R)-4-amino-2-[3-(2,5-dioxopyrrolidin-1-yl)propanoylamino]-4-oxobutanoic acid (PubChem CID 107820981) has the molecular formula C11H15N3O6 and a molecular weight of 285.26 g/mol. Its IUPAC name is (2R)-4-amino-2-[3-(2,5-dioxopyrrolidin-1-yl)propanoylamino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-[3-(2,5-dioxopyrrolidin-1-yl)propanoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107820981 |
| Molecular Formula | C11H15N3O6 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (2R)-4-amino-2-[3-(2,5-dioxopyrrolidin-1-yl)propanoylamino]-4-oxobutanoic acid |
| SMILES | NC(=O)C[C@@H](NC(=O)CCN1C(=O)CCC1=O)C(=O)O |
| InChI | InChI=1S/C11H15N3O6/c12-7(15)5-6(11(19)20)13-8(16)3-4-14-9(17)1-2-10(14)18/h6H,1-5H2,(H2,12,15)(H,13,16)(H,19,20)/t6-/m1/s1 |
| InChIKey | ZRXWAKCLUAXEET-ZCFIWIBFSA-N |
| XLogP | -2.03 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|