C14H20N4O7 — CID 142732287
(2,5-dioxopyrrolidin-1-yl) 6-[[(2S)-1,4-diamino-1,4-dioxobutan-2-yl]amino]-6-oxohexanoate (PubChem CID 142732287) has the molecular formula C14H20N4O7 and a molecular weight of 356.34 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[[(2S)-1,4-diamino-1,4-dioxobutan-2-yl]amino]-6-oxohexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[[(2S)-1,4-diamino-1,4-dioxobutan-2-yl]amino]-6-oxohexanoate |
|---|---|
| PubChem CID | 142732287 |
| Molecular Formula | C14H20N4O7 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[[(2S)-1,4-diamino-1,4-dioxobutan-2-yl]amino]-6-oxohexanoate |
| SMILES | NC(=O)C[C@H](NC(=O)CCCCC(=O)ON1C(=O)CCC1=O)C(N)=O |
| InChI | InChI=1S/C14H20N4O7/c15-9(19)7-8(14(16)24)17-10(20)3-1-2-4-13(23)25-18-11(21)5-6-12(18)22/h8H,1-7H2,(H2,15,19)(H2,16,24)(H,17,20)/t8-/m0/s1 |
| InChIKey | HNCJUAMCFUZFSY-QMMMGPOBSA-N |
| XLogP | -2.00 |
| TPSA | 178.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|