C8H14N2O6S — CID 43357084
4-amino-2-(3-methylsulfonylpropanoylamino)-4-oxobutanoic acid (PubChem CID 43357084) has the molecular formula C8H14N2O6S and a molecular weight of 266.27 g/mol. Its IUPAC name is 4-amino-2-(3-methylsulfonylpropanoylamino)-4-oxobutanoic acid.
| Compound Name | 4-amino-2-(3-methylsulfonylpropanoylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 43357084 |
| Molecular Formula | C8H14N2O6S |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 4-amino-2-(3-methylsulfonylpropanoylamino)-4-oxobutanoic acid |
| SMILES | CS(=O)(=O)CCC(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C8H14N2O6S/c1-17(15,16)3-2-7(12)10-5(8(13)14)4-6(9)11/h5H,2-4H2,1H3,(H2,9,11)(H,10,12)(H,13,14) |
| InChIKey | DQZSEFRTQIMVQF-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 143.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |