C10H18N2O4 — CID 166594796
(2S)-4-amino-2-(6-deuteriohexanoylamino)-4-oxobutanoic acid (PubChem CID 166594796) has the molecular formula C10H18N2O4 and a molecular weight of 231.27 g/mol. Its IUPAC name is (2S)-4-amino-2-(6-deuteriohexanoylamino)-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-(6-deuteriohexanoylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 166594796 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (2S)-4-amino-2-(6-deuteriohexanoylamino)-4-oxobutanoic acid |
| SMILES | [2H]CCCCCC(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H18N2O4/c1-2-3-4-5-9(14)12-7(10(15)16)6-8(11)13/h7H,2-6H2,1H3,(H2,11,13)(H,12,14)(H,15,16)/t7-/m0/s1/i1D |
| InChIKey | JTWUTHJORNEUOX-LAMPMEHRSA-N |
| XLogP | 0.01 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|