C19H34N2O4 — CID 171116631
(2S)-4-amino-4-oxo-2-[[(Z)-pentadec-9-enoyl]amino]butanoic acid (PubChem CID 171116631) has the molecular formula C19H34N2O4 and a molecular weight of 354.49 g/mol. Its IUPAC name is (2S)-4-amino-4-oxo-2-[[(Z)-pentadec-9-enoyl]amino]butanoic acid.
| Compound Name | (2S)-4-amino-4-oxo-2-[[(Z)-pentadec-9-enoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 171116631 |
| Molecular Formula | C19H34N2O4 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | (2S)-4-amino-4-oxo-2-[[(Z)-pentadec-9-enoyl]amino]butanoic acid |
| SMILES | CCCCC/C=C\CCCCCCCC(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C19H34N2O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18(23)21-16(19(24)25)15-17(20)22/h6-7,16H,2-5,8-15H2,1H3,(H2,20,22)(H,21,23)(H,24,25)/b7-6-/t16-/m0/s1 |
| InChIKey | HLDBNEQQZNXRMY-WLMCBFPDSA-N |
| XLogP | 3.30 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|