C21H41ClN2O3 — CID 155550276
(2S)-3-amino-2-[[(Z)-octadec-9-enoyl]amino]propanoic acid;hydrochloride (PubChem CID 155550276) has the molecular formula C21H41ClN2O3 and a molecular weight of 405.02 g/mol. Its IUPAC name is (2S)-3-amino-2-[[(Z)-octadec-9-enoyl]amino]propanoic acid;hydrochloride.
| Compound Name | (2S)-3-amino-2-[[(Z)-octadec-9-enoyl]amino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 155550276 |
| Molecular Formula | C21H41ClN2O3 |
| Molecular Weight | 405.02 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | (2S)-3-amino-2-[[(Z)-octadec-9-enoyl]amino]propanoic acid;hydrochloride |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](CN)C(=O)O.Cl |
| InChI | InChI=1S/C21H40N2O3.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(24)23-19(18-22)21(25)26;/h9-10,19H,2-8,11-18,22H2,1H3,(H,23,24)(H,25,26);1H/b10-9-;/t19-;/m0./s1 |
| InChIKey | JARXWPOVWPCQJZ-PUXKSNPUSA-N |
| XLogP | 4.97 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.02 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|