C22H41NO3 — CID 85040613
2-(octadec-9-enoylamino)butanoic acid (PubChem CID 85040613) has the molecular formula C22H41NO3 and a molecular weight of 367.57 g/mol. Its IUPAC name is 2-(octadec-9-enoylamino)butanoic acid.
| Compound Name | 2-(octadec-9-enoylamino)butanoic acid |
|---|---|
| PubChem CID | 85040613 |
| Molecular Formula | C22H41NO3 |
| Molecular Weight | 367.57 g/mol |
| Exact Mass | 367.31 |
| IUPAC Name | 2-(octadec-9-enoylamino)butanoic acid |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NC(CC)C(=O)O |
| InChI | InChI=1S/C22H41NO3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(24)23-20(4-2)22(25)26/h11-12,20H,3-10,13-19H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | BJWBBLXGIBDIRJ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.57 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|