C22H41NO3S — CID 155102669
2-[[(Z)-octadec-9-enoyl]amino]-4-sulfanylbutanoic acid (PubChem CID 155102669) has the molecular formula C22H41NO3S and a molecular weight of 399.64 g/mol. Its IUPAC name is 2-[[(Z)-octadec-9-enoyl]amino]-4-sulfanylbutanoic acid.
| Compound Name | 2-[[(Z)-octadec-9-enoyl]amino]-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 155102669 |
| Molecular Formula | C22H41NO3S |
| Molecular Weight | 399.64 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | 2-[[(Z)-octadec-9-enoyl]amino]-4-sulfanylbutanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NC(CCS)C(=O)O |
| InChI | InChI=1S/C22H41NO3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)23-20(18-19-27)22(25)26/h9-10,20,27H,2-8,11-19H2,1H3,(H,23,24)(H,25,26)/b10-9- |
| InChIKey | HJEXMDUWYPNFNH-KTKRTIGZSA-N |
| XLogP | 5.91 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.64 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|