C16H28N2O6 — CID 162387723
[(2S)-1-methoxy-1-oxopropan-2-yl] (2S)-4-amino-2-(8-deuteriooctanoylamino)-4-oxobutanoate (PubChem CID 162387723) has the molecular formula C16H28N2O6 and a molecular weight of 345.41 g/mol. Its IUPAC name is [(2S)-1-methoxy-1-oxopropan-2-yl] (2S)-4-amino-2-(8-deuteriooctanoylamino)-4-oxobutanoate.
| Compound Name | [(2S)-1-methoxy-1-oxopropan-2-yl] (2S)-4-amino-2-(8-deuteriooctanoylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 162387723 |
| Molecular Formula | C16H28N2O6 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | [(2S)-1-methoxy-1-oxopropan-2-yl] (2S)-4-amino-2-(8-deuteriooctanoylamino)-4-oxobutanoate |
| SMILES | [2H]CCCCCCCC(=O)N[C@@H](CC(N)=O)C(=O)O[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C16H28N2O6/c1-4-5-6-7-8-9-14(20)18-12(10-13(17)19)16(22)24-11(2)15(21)23-3/h11-12H,4-10H2,1-3H3,(H2,17,19)(H,18,20)/t11-,12-/m0/s1/i1D |
| InChIKey | CPBUMQIGPXZDQQ-JTFRVOOHSA-N |
| XLogP | 0.81 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|