C17H31N3O5 — CID 162387318
methyl (2S)-2-[[(2R)-4-amino-2-(octanoylamino)-4-oxobutanoyl]-methylamino]propanoate (PubChem CID 162387318) has the molecular formula C17H31N3O5 and a molecular weight of 357.45 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R)-4-amino-2-(octanoylamino)-4-oxobutanoyl]-methylamino]propanoate.
| Compound Name | methyl (2S)-2-[[(2R)-4-amino-2-(octanoylamino)-4-oxobutanoyl]-methylamino]propanoate |
|---|---|
| PubChem CID | 162387318 |
| Molecular Formula | C17H31N3O5 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | methyl (2S)-2-[[(2R)-4-amino-2-(octanoylamino)-4-oxobutanoyl]-methylamino]propanoate |
| SMILES | CCCCCCCC(=O)N[C@H](CC(N)=O)C(=O)N(C)[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C17H31N3O5/c1-5-6-7-8-9-10-15(22)19-13(11-14(18)21)16(23)20(3)12(2)17(24)25-4/h12-13H,5-11H2,1-4H3,(H2,18,21)(H,19,22)/t12-,13+/m0/s1 |
| InChIKey | MUNKUHHWCHUWDC-QWHCGFSZSA-N |
| XLogP | 0.73 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|