C20H39NO3 — CID 19368983
methyl 4-methyl-2-(tridecanoylamino)pentanoate (PubChem CID 19368983) has the molecular formula C20H39NO3 and a molecular weight of 341.54 g/mol. Its IUPAC name is methyl 4-methyl-2-(tridecanoylamino)pentanoate.
| Compound Name | methyl 4-methyl-2-(tridecanoylamino)pentanoate |
|---|---|
| PubChem CID | 19368983 |
| Molecular Formula | C20H39NO3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.29 |
| IUPAC Name | methyl 4-methyl-2-(tridecanoylamino)pentanoate |
| SMILES | CCCCCCCCCCCCC(=O)NC(CC(C)C)C(=O)OC |
| InChI | InChI=1S/C20H39NO3/c1-5-6-7-8-9-10-11-12-13-14-15-19(22)21-18(16-17(2)3)20(23)24-4/h17-18H,5-16H2,1-4H3,(H,21,22) |
| InChIKey | FOEDXYVKGPXDKW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|