C23H43N3O5 — CID 21122440
methyl (2S)-2-[[(2S)-2-[[(2S)-2-(decanoylamino)propanoyl]amino]-4-methylpentanoyl]amino]propanoate (PubChem CID 21122440) has the molecular formula C23H43N3O5 and a molecular weight of 441.61 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-[[(2S)-2-(decanoylamino)propanoyl]amino]-4-methylpentanoyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-[[(2S)-2-(decanoylamino)propanoyl]amino]-4-methylpentanoyl]amino]propanoate |
|---|---|
| PubChem CID | 21122440 |
| Molecular Formula | C23H43N3O5 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.32 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-[[(2S)-2-(decanoylamino)propanoyl]amino]-4-methylpentanoyl]amino]propanoate |
| SMILES | CCCCCCCCCC(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C23H43N3O5/c1-7-8-9-10-11-12-13-14-20(27)24-17(4)21(28)26-19(15-16(2)3)22(29)25-18(5)23(30)31-6/h16-19H,7-15H2,1-6H3,(H,24,27)(H,25,29)(H,26,28)/t17-,18-,19-/m0/s1 |
| InChIKey | STNBVWGHTSFTHC-FHWLQOOXSA-N |
| XLogP | 2.84 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|