C16H28N2O6 — CID 146381737
(3R)-4-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-3-(octanoylamino)-4-oxobutanoic acid (PubChem CID 146381737) has the molecular formula C16H28N2O6 and a molecular weight of 344.41 g/mol. Its IUPAC name is (3R)-4-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-3-(octanoylamino)-4-oxobutanoic acid.
| Compound Name | (3R)-4-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-3-(octanoylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 146381737 |
| Molecular Formula | C16H28N2O6 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | (3R)-4-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-3-(octanoylamino)-4-oxobutanoic acid |
| SMILES | CCCCCCCC(=O)N[C@H](CC(=O)O)C(=O)N[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C16H28N2O6/c1-4-5-6-7-8-9-13(19)18-12(10-14(20)21)15(22)17-11(2)16(23)24-3/h11-12H,4-10H2,1-3H3,(H,17,22)(H,18,19)(H,20,21)/t11-,12+/m0/s1 |
| InChIKey | QCFJLWBBSIIWJL-NWDGAFQWSA-N |
| XLogP | 0.98 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|