C14H27N3O4 — CID 162387523
(2R)-N-methoxy-N-methyl-2-(octanoylamino)butanediamide (PubChem CID 162387523) has the molecular formula C14H27N3O4 and a molecular weight of 301.39 g/mol. Its IUPAC name is (2R)-N-methoxy-N-methyl-2-(octanoylamino)butanediamide.
| Compound Name | (2R)-N-methoxy-N-methyl-2-(octanoylamino)butanediamide |
|---|---|
| PubChem CID | 162387523 |
| Molecular Formula | C14H27N3O4 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | (2R)-N-methoxy-N-methyl-2-(octanoylamino)butanediamide |
| SMILES | CCCCCCCC(=O)N[C@H](CC(N)=O)C(=O)N(C)OC |
| InChI | InChI=1S/C14H27N3O4/c1-4-5-6-7-8-9-13(19)16-11(10-12(15)18)14(20)17(2)21-3/h11H,4-10H2,1-3H3,(H2,15,18)(H,16,19)/t11-/m1/s1 |
| InChIKey | HHIKJPKQGLWVMJ-LLVKDONJSA-N |
| XLogP | 0.73 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|