C17H31ClN2O3 — CID 166884598
(5S)-5-chloro-6,6-dimethyl-3-(octanoylamino)-4-oxoheptanamide (PubChem CID 166884598) has the molecular formula C17H31ClN2O3 and a molecular weight of 346.90 g/mol. Its IUPAC name is (5S)-5-chloro-6,6-dimethyl-3-(octanoylamino)-4-oxoheptanamide.
| Compound Name | (5S)-5-chloro-6,6-dimethyl-3-(octanoylamino)-4-oxoheptanamide |
|---|---|
| PubChem CID | 166884598 |
| Molecular Formula | C17H31ClN2O3 |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (5S)-5-chloro-6,6-dimethyl-3-(octanoylamino)-4-oxoheptanamide |
| SMILES | CCCCCCCC(=O)NC(CC(N)=O)C(=O)[C@@H](Cl)C(C)(C)C |
| InChI | InChI=1S/C17H31ClN2O3/c1-5-6-7-8-9-10-14(22)20-12(11-13(19)21)15(23)16(18)17(2,3)4/h12,16H,5-11H2,1-4H3,(H2,19,21)(H,20,22)/t12?,16-/m1/s1 |
| InChIKey | MISVOWCYAUIPBO-PVQCJRHBSA-N |
| XLogP | 2.93 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|