C15H29N5O2 — CID 162387185
N-[(3R,4Z)-1-amino-5-ethylimino-4-hydrazinylidene-1-oxopentan-3-yl]octanamide (PubChem CID 162387185) has the molecular formula C15H29N5O2 and a molecular weight of 311.43 g/mol. Its IUPAC name is N-[(3R,4Z)-1-amino-5-ethylimino-4-hydrazinylidene-1-oxopentan-3-yl]octanamide.
| Compound Name | N-[(3R,4Z)-1-amino-5-ethylimino-4-hydrazinylidene-1-oxopentan-3-yl]octanamide |
|---|---|
| PubChem CID | 162387185 |
| Molecular Formula | C15H29N5O2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.23 |
| IUPAC Name | N-[(3R,4Z)-1-amino-5-ethylimino-4-hydrazinylidene-1-oxopentan-3-yl]octanamide |
| SMILES | CCCCCCCC(=O)N[C@H](CC(N)=O)C(/C=N/CC)=N/N |
| InChI | InChI=1S/C15H29N5O2/c1-3-5-6-7-8-9-15(22)19-12(10-14(16)21)13(20-17)11-18-4-2/h11-12H,3-10,17H2,1-2H3,(H2,16,21)(H,19,22)/b18-11+,20-13+/t12-/m1/s1 |
| InChIKey | YUKZXSKIALAFHX-VXNMRKDMSA-N |
| XLogP | 1.11 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|