C20H38N4O5 — CID 146381764
tert-butyl N-[2-[[(2R)-4-amino-2-(octanoylamino)-4-oxobutanoyl]amino]ethyl]-N-methylcarbamate (PubChem CID 146381764) has the molecular formula C20H38N4O5 and a molecular weight of 414.55 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2R)-4-amino-2-(octanoylamino)-4-oxobutanoyl]amino]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[[(2R)-4-amino-2-(octanoylamino)-4-oxobutanoyl]amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 146381764 |
| Molecular Formula | C20H38N4O5 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | tert-butyl N-[2-[[(2R)-4-amino-2-(octanoylamino)-4-oxobutanoyl]amino]ethyl]-N-methylcarbamate |
| SMILES | CCCCCCCC(=O)N[C@H](CC(N)=O)C(=O)NCCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H38N4O5/c1-6-7-8-9-10-11-17(26)23-15(14-16(21)25)18(27)22-12-13-24(5)19(28)29-20(2,3)4/h15H,6-14H2,1-5H3,(H2,21,25)(H,22,27)(H,23,26)/t15-/m1/s1 |
| InChIKey | OAXOUCCZMINTIV-OAHLLOKOSA-N |
| XLogP | 1.69 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|