C41H48N4O5 — CID 159820187
tert-butyl N-methyl-N-[2-[[(2R)-4-oxo-2-(4-phenylbutanoylamino)-4-(tritylamino)butanoyl]amino]ethyl]carbamate (PubChem CID 159820187) has the molecular formula C41H48N4O5 and a molecular weight of 676.86 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-[[(2R)-4-oxo-2-(4-phenylbutanoylamino)-4-(tritylamino)butanoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[2-[[(2R)-4-oxo-2-(4-phenylbutanoylamino)-4-(tritylamino)butanoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 159820187 |
| Molecular Formula | C41H48N4O5 |
| Molecular Weight | 676.86 g/mol |
| Exact Mass | 676.36 |
| IUPAC Name | tert-butyl N-methyl-N-[2-[[(2R)-4-oxo-2-(4-phenylbutanoylamino)-4-(tritylamino)butanoyl]amino]ethyl]carbamate |
| SMILES | CN(CCNC(=O)[C@@H](CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)CCCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C41H48N4O5/c1-40(2,3)50-39(49)45(4)29-28-42-38(48)35(43-36(46)27-17-20-31-18-9-5-10-19-31)30-37(47)44-41(32-21-11-6-12-22-32,33-23-13-7-14-24-33)34-25-15-8-16-26-34/h5-16,18-19,21-26,35H,17,20,27-30H2,1-4H3,(H,42,48)(H,43,46)(H,44,47)/t35-/m1/s1 |
| InChIKey | NMDCCMQEJNZTKZ-PGUFJCEWSA-N |
| XLogP | 5.98 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.86 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|