C37H40N4O5 — CID 172805857
[(1-amino-3-phenylpropylidene)amino] (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(tritylamino)butanoate (PubChem CID 172805857) has the molecular formula C37H40N4O5 and a molecular weight of 620.75 g/mol. Its IUPAC name is [(1-amino-3-phenylpropylidene)amino] (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(tritylamino)butanoate.
| Compound Name | [(1-amino-3-phenylpropylidene)amino] (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(tritylamino)butanoate |
|---|---|
| PubChem CID | 172805857 |
| Molecular Formula | C37H40N4O5 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.30 |
| IUPAC Name | [(1-amino-3-phenylpropylidene)amino] (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(tritylamino)butanoate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)ON=C(N)CCc1ccccc1 |
| InChI | InChI=1S/C37H40N4O5/c1-36(2,3)45-35(44)39-31(34(43)46-41-32(38)25-24-27-16-8-4-9-17-27)26-33(42)40-37(28-18-10-5-11-19-28,29-20-12-6-13-21-29)30-22-14-7-15-23-30/h4-23,31H,24-26H2,1-3H3,(H2,38,41)(H,39,44)(H,40,42)/t31-/m1/s1 |
| InChIKey | RMQIDRMXGQQOPM-WJOKGBTCSA-N |
| XLogP | 5.83 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|