C32H37N3O4 — CID 140727812
tert-butyl N-[(2S)-1-(but-3-enylamino)-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamate (PubChem CID 140727812) has the molecular formula C32H37N3O4 and a molecular weight of 527.67 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(but-3-enylamino)-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(but-3-enylamino)-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 140727812 |
| Molecular Formula | C32H37N3O4 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | tert-butyl N-[(2S)-1-(but-3-enylamino)-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamate |
| SMILES | C=CCCNC(=O)[C@H](CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H37N3O4/c1-5-6-22-33-29(37)27(34-30(38)39-31(2,3)4)23-28(36)35-32(24-16-10-7-11-17-24,25-18-12-8-13-19-25)26-20-14-9-15-21-26/h5,7-21,27H,1,6,22-23H2,2-4H3,(H,33,37)(H,34,38)(H,35,36)/t27-/m0/s1 |
| InChIKey | HHNYHAFPRGCSBV-MHZLTWQESA-N |
| XLogP | 5.07 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|