C40H47N3O5 — CID 158370703
benzyl N-[1-[[(3R)-3-methyl-4-[(2-methylpropan-2-yl)oxy]butyl]amino]-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamate (PubChem CID 158370703) has the molecular formula C40H47N3O5 and a molecular weight of 649.83 g/mol. Its IUPAC name is benzyl N-[1-[[(3R)-3-methyl-4-[(2-methylpropan-2-yl)oxy]butyl]amino]-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[[(3R)-3-methyl-4-[(2-methylpropan-2-yl)oxy]butyl]amino]-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 158370703 |
| Molecular Formula | C40H47N3O5 |
| Molecular Weight | 649.83 g/mol |
| Exact Mass | 649.35 |
| IUPAC Name | benzyl N-[1-[[(3R)-3-methyl-4-[(2-methylpropan-2-yl)oxy]butyl]amino]-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamate |
| SMILES | C[C@H](CCNC(=O)C(CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OCc1ccccc1)COC(C)(C)C |
| InChI | InChI=1S/C40H47N3O5/c1-30(28-48-39(2,3)4)25-26-41-37(45)35(42-38(46)47-29-31-17-9-5-10-18-31)27-36(44)43-40(32-19-11-6-12-20-32,33-21-13-7-14-22-33)34-23-15-8-16-24-34/h5-24,30,35H,25-29H2,1-4H3,(H,41,45)(H,42,46)(H,43,44)/t30-,35?/m1/s1 |
| InChIKey | AMKIIBUOUJNNPO-OSRRZMJMSA-N |
| XLogP | 6.74 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.83 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|