C16H25NO4 — CID 70035125
benzyl N-[(3S)-3-hydroxy-4-[(2-methylpropan-2-yl)oxy]butyl]carbamate (PubChem CID 70035125) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is benzyl N-[(3S)-3-hydroxy-4-[(2-methylpropan-2-yl)oxy]butyl]carbamate.
| Compound Name | benzyl N-[(3S)-3-hydroxy-4-[(2-methylpropan-2-yl)oxy]butyl]carbamate |
|---|---|
| PubChem CID | 70035125 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | benzyl N-[(3S)-3-hydroxy-4-[(2-methylpropan-2-yl)oxy]butyl]carbamate |
| SMILES | CC(C)(C)OC[C@@H](O)CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H25NO4/c1-16(2,3)21-12-14(18)9-10-17-15(19)20-11-13-7-5-4-6-8-13/h4-8,14,18H,9-12H2,1-3H3,(H,17,19)/t14-/m0/s1 |
| InChIKey | ZDUIGRVCMRHAQE-AWEZNQCLSA-N |
| XLogP | 2.48 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |