C34H37NO6 — CID 68749958
benzyl N-[5-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypentyl]carbamate (PubChem CID 68749958) has the molecular formula C34H37NO6 and a molecular weight of 555.67 g/mol. Its IUPAC name is benzyl N-[5-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypentyl]carbamate.
| Compound Name | benzyl N-[5-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypentyl]carbamate |
|---|---|
| PubChem CID | 68749958 |
| Molecular Formula | C34H37NO6 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | benzyl N-[5-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypentyl]carbamate |
| SMILES | COc1ccc(C(OCCC(O)CCNC(=O)OCc2ccccc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H37NO6/c1-38-31-17-13-28(14-18-31)34(27-11-7-4-8-12-27,29-15-19-32(39-2)20-16-29)41-24-22-30(36)21-23-35-33(37)40-25-26-9-5-3-6-10-26/h3-20,30,36H,21-25H2,1-2H3,(H,35,37) |
| InChIKey | PQXYKEVEWGWSBR-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|