C44H50Cl2N2O8 — CID 158234775
benzyl N-[(2S)-2,4-dihydroxybutyl]carbamate;benzyl N-[(2S)-2-hydroxy-4-trityloxybutyl]carbamate;dichloromethane (PubChem CID 158234775) has the molecular formula C44H50Cl2N2O8 and a molecular weight of 805.80 g/mol. Its IUPAC name is benzyl N-[(2S)-2,4-dihydroxybutyl]carbamate;benzyl N-[(2S)-2-hydroxy-4-trityloxybutyl]carbamate;dichloromethane.
| Compound Name | benzyl N-[(2S)-2,4-dihydroxybutyl]carbamate;benzyl N-[(2S)-2-hydroxy-4-trityloxybutyl]carbamate;dichloromethane |
|---|---|
| PubChem CID | 158234775 |
| Molecular Formula | C44H50Cl2N2O8 |
| Molecular Weight | 805.80 g/mol |
| Exact Mass | 804.29 |
| IUPAC Name | benzyl N-[(2S)-2,4-dihydroxybutyl]carbamate;benzyl N-[(2S)-2-hydroxy-4-trityloxybutyl]carbamate;dichloromethane |
| SMILES | ClCCl.O=C(NC[C@@H](O)CCO)OCc1ccccc1.O=C(NC[C@@H](O)CCOC(c1ccccc1)(c1ccccc1)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C31H31NO4.C12H17NO4.CH2Cl2/c33-29(23-32-30(34)35-24-25-13-5-1-6-14-25)21-22-36-31(26-15-7-2-8-16-26,27-17-9-3-10-18-27)28-19-11-4-12-20-28;14-7-6-11(15)8-13-12(16)17-9-10-4-2-1-3-5-10;2-1-3/h1-20,29,33H,21-24H2,(H,32,34);1-5,11,14-15H,6-9H2,(H,13,16);1H2/t29-;11-;/m00./s1 |
| InChIKey | GEVCHIOATBJUIC-PUNOIYHESA-N |
| XLogP | 7.75 |
| TPSA | 146.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.80 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|