C27H32N2O3 — CID 21023353
4-amino-N-[(2R)-2-hydroxy-4-trityloxybutyl]butanamide (PubChem CID 21023353) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is 4-amino-N-[(2R)-2-hydroxy-4-trityloxybutyl]butanamide.
| Compound Name | 4-amino-N-[(2R)-2-hydroxy-4-trityloxybutyl]butanamide |
|---|---|
| PubChem CID | 21023353 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 4-amino-N-[(2R)-2-hydroxy-4-trityloxybutyl]butanamide |
| SMILES | NCCCC(=O)NC[C@H](O)CCOC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H32N2O3/c28-19-10-17-26(31)29-21-25(30)18-20-32-27(22-11-4-1-5-12-22,23-13-6-2-7-14-23)24-15-8-3-9-16-24/h1-9,11-16,25,30H,10,17-21,28H2,(H,29,31)/t25-/m1/s1 |
| InChIKey | BXURGQGSPKGQGK-RUZDIDTESA-N |
| XLogP | 3.60 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|