C30H38O4 — CID 143649283
1-[bis(4-methoxyphenyl)-phenylmethoxy]nonan-3-ol (PubChem CID 143649283) has the molecular formula C30H38O4 and a molecular weight of 462.63 g/mol. Its IUPAC name is 1-[bis(4-methoxyphenyl)-phenylmethoxy]nonan-3-ol.
| Compound Name | 1-[bis(4-methoxyphenyl)-phenylmethoxy]nonan-3-ol |
|---|---|
| PubChem CID | 143649283 |
| Molecular Formula | C30H38O4 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | 1-[bis(4-methoxyphenyl)-phenylmethoxy]nonan-3-ol |
| SMILES | CCCCCCC(O)CCOC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H38O4/c1-4-5-6-10-13-27(31)22-23-34-30(24-11-8-7-9-12-24,25-14-18-28(32-2)19-15-25)26-16-20-29(33-3)21-17-26/h7-9,11-12,14-21,27,31H,4-6,10,13,22-23H2,1-3H3 |
| InChIKey | MPKCPOVHKUBQBG-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|