C34H44O6 — CID 162096764
[1-[bis(4-methoxyphenyl)-phenylmethoxy]-7-hydroxyundecan-6-yl] acetate (PubChem CID 162096764) has the molecular formula C34H44O6 and a molecular weight of 548.72 g/mol. Its IUPAC name is [1-[bis(4-methoxyphenyl)-phenylmethoxy]-7-hydroxyundecan-6-yl] acetate.
| Compound Name | [1-[bis(4-methoxyphenyl)-phenylmethoxy]-7-hydroxyundecan-6-yl] acetate |
|---|---|
| PubChem CID | 162096764 |
| Molecular Formula | C34H44O6 |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | [1-[bis(4-methoxyphenyl)-phenylmethoxy]-7-hydroxyundecan-6-yl] acetate |
| SMILES | CCCCC(O)C(CCCCCOC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1)OC(C)=O |
| InChI | InChI=1S/C34H44O6/c1-5-6-15-32(36)33(40-26(2)35)16-11-8-12-25-39-34(27-13-9-7-10-14-27,28-17-21-30(37-3)22-18-28)29-19-23-31(38-4)24-20-29/h7,9-10,13-14,17-24,32-33,36H,5-6,8,11-12,15-16,25H2,1-4H3 |
| InChIKey | ZEISJNYXLBFTDE-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|