C37H51NO4 — CID 131736534
4-methoxy-2-[4-[(4-methoxyphenyl)-diphenylmethoxy]butyl]dodecanamide (PubChem CID 131736534) has the molecular formula C37H51NO4 and a molecular weight of 573.82 g/mol. Its IUPAC name is 4-methoxy-2-[4-[(4-methoxyphenyl)-diphenylmethoxy]butyl]dodecanamide.
| Compound Name | 4-methoxy-2-[4-[(4-methoxyphenyl)-diphenylmethoxy]butyl]dodecanamide |
|---|---|
| PubChem CID | 131736534 |
| Molecular Formula | C37H51NO4 |
| Molecular Weight | 573.82 g/mol |
| Exact Mass | 573.38 |
| IUPAC Name | 4-methoxy-2-[4-[(4-methoxyphenyl)-diphenylmethoxy]butyl]dodecanamide |
| SMILES | CCCCCCCCC(CC(CCCCOC(c1ccccc1)(c1ccccc1)c1ccc(OC)cc1)C(N)=O)OC |
| InChI | InChI=1S/C37H51NO4/c1-4-5-6-7-8-15-23-35(41-3)29-30(36(38)39)18-16-17-28-42-37(31-19-11-9-12-20-31,32-21-13-10-14-22-32)33-24-26-34(40-2)27-25-33/h9-14,19-22,24-27,30,35H,4-8,15-18,23,28-29H2,1-3H3,(H2,38,39) |
| InChIKey | IPCSUQJDLJAKKJ-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.82 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|