C35H46O4S — CID 135574414
S-[(2S)-1-hexoxy-3-[(4-methoxyphenyl)-diphenylmethoxy]propan-2-yl] 4-methylpentanethioate (PubChem CID 135574414) has the molecular formula C35H46O4S and a molecular weight of 562.82 g/mol. Its IUPAC name is S-[(2S)-1-hexoxy-3-[(4-methoxyphenyl)-diphenylmethoxy]propan-2-yl] 4-methylpentanethioate.
| Compound Name | S-[(2S)-1-hexoxy-3-[(4-methoxyphenyl)-diphenylmethoxy]propan-2-yl] 4-methylpentanethioate |
|---|---|
| PubChem CID | 135574414 |
| Molecular Formula | C35H46O4S |
| Molecular Weight | 562.82 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | S-[(2S)-1-hexoxy-3-[(4-methoxyphenyl)-diphenylmethoxy]propan-2-yl] 4-methylpentanethioate |
| SMILES | CCCCCCOC[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccc(OC)cc1)SC(=O)CCC(C)C |
| InChI | InChI=1S/C35H46O4S/c1-5-6-7-14-25-38-26-33(40-34(36)24-19-28(2)3)27-39-35(29-15-10-8-11-16-29,30-17-12-9-13-18-30)31-20-22-32(37-4)23-21-31/h8-13,15-18,20-23,28,33H,5-7,14,19,24-27H2,1-4H3/t33-/m0/s1 |
| InChIKey | GAWVXYUZXPLZGM-XIFFEERXSA-N |
| XLogP | 8.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.82 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|