C39H54O4S — CID 135587657
S-[(2S)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-octoxypropan-2-yl] octanethioate (PubChem CID 135587657) has the molecular formula C39H54O4S and a molecular weight of 618.92 g/mol. Its IUPAC name is S-[(2S)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-octoxypropan-2-yl] octanethioate.
| Compound Name | S-[(2S)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-octoxypropan-2-yl] octanethioate |
|---|---|
| PubChem CID | 135587657 |
| Molecular Formula | C39H54O4S |
| Molecular Weight | 618.92 g/mol |
| Exact Mass | 618.37 |
| IUPAC Name | S-[(2S)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-octoxypropan-2-yl] octanethioate |
| SMILES | CCCCCCCCOC[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccc(OC)cc1)SC(=O)CCCCCCC |
| InChI | InChI=1S/C39H54O4S/c1-4-6-8-10-12-20-30-42-31-37(44-38(40)25-19-11-9-7-5-2)32-43-39(33-21-15-13-16-22-33,34-23-17-14-18-24-34)35-26-28-36(41-3)29-27-35/h13-18,21-24,26-29,37H,4-12,19-20,25,30-32H2,1-3H3/t37-/m0/s1 |
| InChIKey | HXMPHRSAWPFRPK-QNGWXLTQSA-N |
| XLogP | 10.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.92 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|