C30H34O4S — CID 10097117
S-[(2R)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-[(Z)-pent-2-enoxy]propan-2-yl] ethanethioate (PubChem CID 10097117) has the molecular formula C30H34O4S and a molecular weight of 490.67 g/mol. Its IUPAC name is S-[(2R)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-[(Z)-pent-2-enoxy]propan-2-yl] ethanethioate.
| Compound Name | S-[(2R)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-[(Z)-pent-2-enoxy]propan-2-yl] ethanethioate |
|---|---|
| PubChem CID | 10097117 |
| Molecular Formula | C30H34O4S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | S-[(2R)-1-[(4-methoxyphenyl)-diphenylmethoxy]-3-[(Z)-pent-2-enoxy]propan-2-yl] ethanethioate |
| SMILES | CC/C=C\COC[C@H](COC(c1ccccc1)(c1ccccc1)c1ccc(OC)cc1)SC(C)=O |
| InChI | InChI=1S/C30H34O4S/c1-4-5-12-21-33-22-29(35-24(2)31)23-34-30(25-13-8-6-9-14-25,26-15-10-7-11-16-26)27-17-19-28(32-3)20-18-27/h5-20,29H,4,21-23H2,1-3H3/b12-5-/t29-/m1/s1 |
| InChIKey | UZZJIGIEQZEAII-SXHFYYIESA-N |
| XLogP | 6.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|