C30H34O5 — CID 54451752
6-[4-[(4-methoxyphenyl)-diphenylmethoxy]but-2-enoxy]hexanoic acid (PubChem CID 54451752) has the molecular formula C30H34O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is 6-[4-[(4-methoxyphenyl)-diphenylmethoxy]but-2-enoxy]hexanoic acid.
| Compound Name | 6-[4-[(4-methoxyphenyl)-diphenylmethoxy]but-2-enoxy]hexanoic acid |
|---|---|
| PubChem CID | 54451752 |
| Molecular Formula | C30H34O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 6-[4-[(4-methoxyphenyl)-diphenylmethoxy]but-2-enoxy]hexanoic acid |
| SMILES | COc1ccc(C(OCC=CCOCCCCCC(=O)O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H34O5/c1-33-28-20-18-27(19-21-28)30(25-13-5-2-6-14-25,26-15-7-3-8-16-26)35-24-12-11-23-34-22-10-4-9-17-29(31)32/h2-3,5-8,11-16,18-21H,4,9-10,17,22-24H2,1H3,(H,31,32) |
| InChIKey | WVLGIKFPJAYBID-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|