C37H48O12 — CID 18974823
4-[2-[2-[2-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-4-oxobutanoic acid (PubChem CID 18974823) has the molecular formula C37H48O12 and a molecular weight of 684.78 g/mol. Its IUPAC name is 4-[2-[2-[2-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-[2-[2-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18974823 |
| Molecular Formula | C37H48O12 |
| Molecular Weight | 684.78 g/mol |
| Exact Mass | 684.31 |
| IUPAC Name | 4-[2-[2-[2-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-4-oxobutanoic acid |
| SMILES | COc1ccc(C(OCCOCCOCCOCCOCCOCCOC(=O)CCC(=O)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H48O12/c1-41-33-12-8-31(9-13-33)37(30-6-4-3-5-7-30,32-10-14-34(42-2)15-11-32)49-29-27-47-25-23-45-21-19-43-18-20-44-22-24-46-26-28-48-36(40)17-16-35(38)39/h3-15H,16-29H2,1-2H3,(H,38,39) |
| InChIKey | ZSKPKLUVMXRKQF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.78 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|