C37H46O8S — CID 142879736
[4-[3-[2-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propyl]thiophen-2-yl]methanol (PubChem CID 142879736) has the molecular formula C37H46O8S and a molecular weight of 650.83 g/mol. Its IUPAC name is [4-[3-[2-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propyl]thiophen-2-yl]methanol.
| Compound Name | [4-[3-[2-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propyl]thiophen-2-yl]methanol |
|---|---|
| PubChem CID | 142879736 |
| Molecular Formula | C37H46O8S |
| Molecular Weight | 650.83 g/mol |
| Exact Mass | 650.29 |
| IUPAC Name | [4-[3-[2-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propyl]thiophen-2-yl]methanol |
| SMILES | COc1ccc(C(OCCOCCOCCOCCOCCCc2csc(CO)c2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H46O8S/c1-39-34-14-10-32(11-15-34)37(31-8-4-3-5-9-31,33-12-16-35(40-2)17-13-33)45-26-25-44-24-23-43-22-21-42-20-19-41-18-6-7-30-27-36(28-38)46-29-30/h3-5,8-17,27,29,38H,6-7,18-26,28H2,1-2H3 |
| InChIKey | MTSKZBJRHDGHMX-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.83 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|