C33H38N2O2 — CID 53469286
3-[[3-(dimethylamino)phenyl]-(4-methoxyphenyl)-(3-phenylpropoxy)methyl]-N,N-dimethylaniline (PubChem CID 53469286) has the molecular formula C33H38N2O2 and a molecular weight of 494.68 g/mol. Its IUPAC name is 3-[[3-(dimethylamino)phenyl]-(4-methoxyphenyl)-(3-phenylpropoxy)methyl]-N,N-dimethylaniline.
| Compound Name | 3-[[3-(dimethylamino)phenyl]-(4-methoxyphenyl)-(3-phenylpropoxy)methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 53469286 |
| Molecular Formula | C33H38N2O2 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | 3-[[3-(dimethylamino)phenyl]-(4-methoxyphenyl)-(3-phenylpropoxy)methyl]-N,N-dimethylaniline |
| SMILES | COc1ccc(C(OCCCc2ccccc2)(c2cccc(N(C)C)c2)c2cccc(N(C)C)c2)cc1 |
| InChI | InChI=1S/C33H38N2O2/c1-34(2)30-17-9-15-28(24-30)33(27-19-21-32(36-5)22-20-27,29-16-10-18-31(25-29)35(3)4)37-23-11-14-26-12-7-6-8-13-26/h6-10,12-13,15-22,24-25H,11,14,23H2,1-5H3 |
| InChIKey | JKULWNCINOLOAW-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|