C35H37NO5 — CID 144822259
2-[4-[bis(4-methoxyphenyl)-phenylmethoxy]butyl]isoindole-1,3-dione;ethane (PubChem CID 144822259) has the molecular formula C35H37NO5 and a molecular weight of 551.68 g/mol. Its IUPAC name is 2-[4-[bis(4-methoxyphenyl)-phenylmethoxy]butyl]isoindole-1,3-dione;ethane.
| Compound Name | 2-[4-[bis(4-methoxyphenyl)-phenylmethoxy]butyl]isoindole-1,3-dione;ethane |
|---|---|
| PubChem CID | 144822259 |
| Molecular Formula | C35H37NO5 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | 2-[4-[bis(4-methoxyphenyl)-phenylmethoxy]butyl]isoindole-1,3-dione;ethane |
| SMILES | CC.COc1ccc(C(OCCCCN2C(=O)c3ccccc3C2=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H31NO5.C2H6/c1-37-27-18-14-25(15-19-27)33(24-10-4-3-5-11-24,26-16-20-28(38-2)21-17-26)39-23-9-8-22-34-31(35)29-12-6-7-13-30(29)32(34)36;1-2/h3-7,10-21H,8-9,22-23H2,1-2H3;1-2H3 |
| InChIKey | GMGIQFZIBNOZKF-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|