C32H33NO5 — CID 123631928
1-[4-[bis(4-methoxyphenyl)-phenylmethoxy]butyl]-3-ethenyl-4-methylpyrrole-2,5-dione (PubChem CID 123631928) has the molecular formula C32H33NO5 and a molecular weight of 511.62 g/mol. Its IUPAC name is 1-[4-[bis(4-methoxyphenyl)-phenylmethoxy]butyl]-3-ethenyl-4-methylpyrrole-2,5-dione.
| Compound Name | 1-[4-[bis(4-methoxyphenyl)-phenylmethoxy]butyl]-3-ethenyl-4-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 123631928 |
| Molecular Formula | C32H33NO5 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 1-[4-[bis(4-methoxyphenyl)-phenylmethoxy]butyl]-3-ethenyl-4-methylpyrrole-2,5-dione |
| SMILES | C=CC1=C(C)C(=O)N(CCCCOC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C32H33NO5/c1-5-29-23(2)30(34)33(31(29)35)21-9-10-22-38-32(24-11-7-6-8-12-24,25-13-17-27(36-3)18-14-25)26-15-19-28(37-4)20-16-26/h5-8,11-20H,1,9-10,21-22H2,2-4H3 |
| InChIKey | MGTQPFJPQXOFPG-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|