C32H30O5S — CID 23508707
S-(4-formylphenyl) 4-[bis(4-methoxyphenyl)-phenylmethoxy]butanethioate (PubChem CID 23508707) has the molecular formula C32H30O5S and a molecular weight of 526.65 g/mol. Its IUPAC name is S-(4-formylphenyl) 4-[bis(4-methoxyphenyl)-phenylmethoxy]butanethioate.
| Compound Name | S-(4-formylphenyl) 4-[bis(4-methoxyphenyl)-phenylmethoxy]butanethioate |
|---|---|
| PubChem CID | 23508707 |
| Molecular Formula | C32H30O5S |
| Molecular Weight | 526.65 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | S-(4-formylphenyl) 4-[bis(4-methoxyphenyl)-phenylmethoxy]butanethioate |
| SMILES | COc1ccc(C(OCCCC(=O)Sc2ccc(C=O)cc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H30O5S/c1-35-28-16-12-26(13-17-28)32(25-7-4-3-5-8-25,27-14-18-29(36-2)19-15-27)37-22-6-9-31(34)38-30-20-10-24(23-33)11-21-30/h3-5,7-8,10-21,23H,6,9,22H2,1-2H3 |
| InChIKey | PTBKLESVHZWJGJ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.65 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|