C25H28O4S2 — CID 11408463
2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyldisulfanyl]ethanol (PubChem CID 11408463) has the molecular formula C25H28O4S2 and a molecular weight of 456.63 g/mol. Its IUPAC name is 2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyldisulfanyl]ethanol.
| Compound Name | 2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyldisulfanyl]ethanol |
|---|---|
| PubChem CID | 11408463 |
| Molecular Formula | C25H28O4S2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyldisulfanyl]ethanol |
| SMILES | COc1ccc(C(OCCSSCCO)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H28O4S2/c1-27-23-12-8-21(9-13-23)25(20-6-4-3-5-7-20,29-17-19-31-30-18-16-26)22-10-14-24(28-2)15-11-22/h3-15,26H,16-19H2,1-2H3 |
| InChIKey | UUAIRESVAHNJJH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|