C30H31NO6 — CID 68665796
[4-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]-6-(hydroxymethyl)-2-pyridinyl]methanol (PubChem CID 68665796) has the molecular formula C30H31NO6 and a molecular weight of 501.58 g/mol. Its IUPAC name is [4-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]-6-(hydroxymethyl)-2-pyridinyl]methanol.
| Compound Name | [4-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]-6-(hydroxymethyl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 68665796 |
| Molecular Formula | C30H31NO6 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | [4-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]-6-(hydroxymethyl)-2-pyridinyl]methanol |
| SMILES | COc1ccc(C(OCCOc2cc(CO)nc(CO)c2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H31NO6/c1-34-27-12-8-23(9-13-27)30(22-6-4-3-5-7-22,24-10-14-28(35-2)15-11-24)37-17-16-36-29-18-25(20-32)31-26(19-29)21-33/h3-15,18-19,32-33H,16-17,20-21H2,1-2H3 |
| InChIKey | CDMGSYGIYBYROI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|