C33H45NO8 — CID 54065876
2-[2-[2-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine (PubChem CID 54065876) has the molecular formula C33H45NO8 and a molecular weight of 583.72 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine.
| Compound Name | 2-[2-[2-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 54065876 |
| Molecular Formula | C33H45NO8 |
| Molecular Weight | 583.72 g/mol |
| Exact Mass | 583.31 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
| SMILES | COc1ccc(C(OCCOCCOCCOCCOCCOCCN)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H45NO8/c1-35-31-12-8-29(9-13-31)33(28-6-4-3-5-7-28,30-10-14-32(36-2)15-11-30)42-27-26-41-25-24-40-23-22-39-21-20-38-19-18-37-17-16-34/h3-15H,16-27,34H2,1-2H3 |
| InChIKey | MCXXSBDIIQFSQI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.72 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|