C42H62NO14PSi — CID 169034043
2-[2-[2-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-cyanoethyl 3-trimethoxysilylpropyl phosphite (PubChem CID 169034043) has the molecular formula C42H62NO14PSi and a molecular weight of 864.01 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-cyanoethyl 3-trimethoxysilylpropyl phosphite.
| Compound Name | 2-[2-[2-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-cyanoethyl 3-trimethoxysilylpropyl phosphite |
|---|---|
| PubChem CID | 169034043 |
| Molecular Formula | C42H62NO14PSi |
| Molecular Weight | 864.01 g/mol |
| Exact Mass | 863.37 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-cyanoethyl 3-trimethoxysilylpropyl phosphite |
| SMILES | COc1ccc(C(OCCOCCOCCOCCOCCOCCOP(OCCC#N)OCCC[Si](OC)(OC)OC)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C42H62NO14PSi/c1-44-40-17-13-38(14-18-40)42(37-11-7-6-8-12-37,39-15-19-41(45-2)20-16-39)54-34-32-52-30-28-50-26-24-49-25-27-51-29-31-53-33-35-57-58(55-22-9-21-43)56-23-10-36-59(46-3,47-4)48-5/h6-8,11-20H,9-10,22-36H2,1-5H3 |
| InChIKey | MGFHZGUSQIPNKQ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 153.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.01 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|