C40H48N3O8P — CID 172625442
3-[1-[5-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]-2-nitrophenyl]ethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 172625442) has the molecular formula C40H48N3O8P and a molecular weight of 729.81 g/mol. Its IUPAC name is 3-[1-[5-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]-2-nitrophenyl]ethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[1-[5-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]-2-nitrophenyl]ethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 172625442 |
| Molecular Formula | C40H48N3O8P |
| Molecular Weight | 729.81 g/mol |
| Exact Mass | 729.32 |
| IUPAC Name | 3-[1-[5-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]-2-nitrophenyl]ethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | COc1ccc(C(OCCOc2ccc([N+](=O)[O-])c(C(C)OP(OCCC#N)N(C(C)C)C(C)C)c2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H48N3O8P/c1-29(2)42(30(3)4)52(50-25-11-24-41)51-31(5)38-28-37(22-23-39(38)43(44)45)48-26-27-49-40(32-12-9-8-10-13-32,33-14-18-35(46-6)19-15-33)34-16-20-36(47-7)21-17-34/h8-10,12-23,28-31H,11,25-27H2,1-7H3 |
| InChIKey | XPXDVVWAPHZWMJ-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 125.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.81 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|