C42H49N2O7P — CID 170721843
3-[[(2S)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[(3-oxo-1,2-dihydroinden-5-yl)oxy]propan-2-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 170721843) has the molecular formula C42H49N2O7P and a molecular weight of 724.84 g/mol. Its IUPAC name is 3-[[(2S)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[(3-oxo-1,2-dihydroinden-5-yl)oxy]propan-2-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(2S)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[(3-oxo-1,2-dihydroinden-5-yl)oxy]propan-2-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 170721843 |
| Molecular Formula | C42H49N2O7P |
| Molecular Weight | 724.84 g/mol |
| Exact Mass | 724.33 |
| IUPAC Name | 3-[[(2S)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[(3-oxo-1,2-dihydroinden-5-yl)oxy]propan-2-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | COc1ccc(C(OC[C@H](COc2ccc3c(c2)C(=O)CC3)OP(OCCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C42H49N2O7P/c1-30(2)44(31(3)4)52(50-26-10-25-43)51-39(28-48-38-19-13-32-14-24-41(45)40(32)27-38)29-49-42(33-11-8-7-9-12-33,34-15-20-36(46-5)21-16-34)35-17-22-37(47-6)23-18-35/h7-9,11-13,15-23,27,30-31,39H,10,14,24,26,28-29H2,1-6H3/t39-,52?/m0/s1 |
| InChIKey | LRNJAZPRJVGIQY-KYWZKBOKSA-N |
| XLogP | 8.88 |
| TPSA | 99.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.84 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|